About 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene
2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 12937299) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene.
Molecular Properties
| Compound Name | 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene |
| PubChem CID | 12937299 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | COC1C=CC2(CCC(C)O2)O1 |
| InChI | InChI=1S/C9H14O3/c1-7-3-5-9(11-7)6-4-8(10-2)12-9/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | QCMFTPARLNFGIU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene?
The IUPAC name of 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene (CID 12937299) is 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene.
What is the SMILES notation for 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene?
The canonical SMILES for 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene is COC1C=CC2(CCC(C)O2)O1.
What is the InChIKey of 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene?
The InChIKey is QCMFTPARLNFGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7-3-5-9(11-7)6-4-8(10-2)12-9/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene?
2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene has a molecular weight of 170.21 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-7-methyl-1,6-dioxaspiro[4.4]non-3-ene is sourced from PubChem (CID 12937299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).