C11H12ClN3O — CID 129373246
4-chloro-1-[(2R)-oxan-2-yl]pyrazolo[4,5-c]pyridine (PubChem CID 129373246) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-chloro-1-[(2R)-oxan-2-yl]pyrazolo[4,5-c]pyridine.
| Compound Name | 4-chloro-1-[(2R)-oxan-2-yl]pyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 129373246 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-chloro-1-[(2R)-oxan-2-yl]pyrazolo[4,5-c]pyridine |
| SMILES | Clc1nccc2c1cnn2[C@H]1CCCCO1 |
| InChI | InChI=1S/C11H12ClN3O/c12-11-8-7-14-15(9(8)4-5-13-11)10-3-1-2-6-16-10/h4-5,7,10H,1-3,6H2/t10-/m1/s1 |
| InChIKey | UANLOHJWPCEBNP-SNVBAGLBSA-N |
| XLogP | 2.78 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|