About (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione
(3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione (PubChem CID 129373411) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione.
Molecular Properties
| Compound Name | (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione |
| PubChem CID | 129373411 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](C(C)=O)C1=O |
| InChI | InChI=1S/C10H15NO3/c1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h5,7-8H,4H2,1-3H3,(H,11,14)/t5-,7+,8-/m0/s1 |
| InChIKey | KLBSRSYHIIAQTG-ARDNSNSESA-N |
| XLogP | 0.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione?
The IUPAC name of (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione (CID 129373411) is (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione.
What is the SMILES notation for (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione?
The canonical SMILES for (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione is CC[C@H](C)[C@@H]1NC(=O)[C@H](C(C)=O)C1=O.
What is the InChIKey of (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione?
The InChIKey is KLBSRSYHIIAQTG-ARDNSNSESA-N. The full InChI is InChI=1S/C10H15NO3/c1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h5,7-8H,4H2,1-3H3,(H,11,14)/t5-,7+,8-/m0/s1.
What are the key properties of (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione?
(3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione has a molecular weight of 197.23 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3-acetyl-5-[(2S)-butan-2-yl]pyrrolidine-2,4-dione is sourced from PubChem (CID 129373411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).