C10H22N2O — CID 129373454
(2S,4R)-2-hydroxy-4,6,6-trimethylheptanimidamide (PubChem CID 129373454) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2S,4R)-2-hydroxy-4,6,6-trimethylheptanimidamide.
| Compound Name | (2S,4R)-2-hydroxy-4,6,6-trimethylheptanimidamide |
|---|---|
| PubChem CID | 129373454 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2S,4R)-2-hydroxy-4,6,6-trimethylheptanimidamide |
| SMILES | [H]/N=C(\N)[C@@H](O)C[C@H](C)CC(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(6-10(2,3)4)5-8(13)9(11)12/h7-8,13H,5-6H2,1-4H3,(H3,11,12)/t7-,8-/m0/s1 |
| InChIKey | XKOYRINHYXCTFX-YUMQZZPRSA-N |
| XLogP | 1.75 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|