C11H14O4 — CID 129374708
2-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]acetic acid (PubChem CID 129374708) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]acetic acid.
| Compound Name | 2-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 129374708 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]acetic acid |
| SMILES | C[C@]12CC[C@H](C(=O)C1=O)[C@@]2(C)CC(=O)O |
| InChI | InChI=1S/C11H14O4/c1-10-4-3-6(8(14)9(10)15)11(10,2)5-7(12)13/h6H,3-5H2,1-2H3,(H,12,13)/t6-,10+,11-/m1/s1 |
| InChIKey | ONAMPECMKOSVMX-LIEZGIJOSA-N |
| XLogP | 1.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|