C6H10O3 — CID 129375020
1-[(1S)-1-hydroxyethyl]cyclopropane-1-carboxylic acid (PubChem CID 129375020) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 1-[(1S)-1-hydroxyethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(1S)-1-hydroxyethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 129375020 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1-[(1S)-1-hydroxyethyl]cyclopropane-1-carboxylic acid |
| SMILES | C[C@H](O)C1(C(=O)O)CC1 |
| InChI | InChI=1S/C6H10O3/c1-4(7)6(2-3-6)5(8)9/h4,7H,2-3H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | YMQUSWXJUCTILM-BYPYZUCNSA-N |
| XLogP | 0.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |