C11H14BrNO — CID 129375178
[(3S,4R)-4-(4-bromophenyl)pyrrolidin-3-yl]methanol (PubChem CID 129375178) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is [(3S,4R)-4-(4-bromophenyl)pyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4R)-4-(4-bromophenyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 129375178 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | [(3S,4R)-4-(4-bromophenyl)pyrrolidin-3-yl]methanol |
| SMILES | OC[C@@H]1CNC[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrNO/c12-10-3-1-8(2-4-10)11-6-13-5-9(11)7-14/h1-4,9,11,13-14H,5-7H2/t9-,11-/m0/s1 |
| InChIKey | ZSRDUHBUWUQNBM-ONGXEEELSA-N |
| XLogP | 1.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |