C16H23NO3 — CID 129375300
(1R,2R,3S,4R)-3-(azepane-1-carbonyl)bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 129375300) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (1R,2R,3S,4R)-3-(azepane-1-carbonyl)bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4R)-3-(azepane-1-carbonyl)bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 129375300 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1R,2R,3S,4R)-3-(azepane-1-carbonyl)bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H](C(=O)N2CCCCCC2)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C16H23NO3/c18-15(17-9-3-1-2-4-10-17)13-11-5-7-12(8-6-11)14(13)16(19)20/h5,7,11-14H,1-4,6,8-10H2,(H,19,20)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | TVFBUFUYEFLRFN-XDQVBPFNSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|