C34H37FN4O2S — CID 129375909
N,N-dibenzyl-2-[[4-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 129375909) has the molecular formula C34H37FN4O2S and a molecular weight of 584.76 g/mol. Its IUPAC name is N,N-dibenzyl-2-[[4-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N,N-dibenzyl-2-[[4-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 129375909 |
| Molecular Formula | C34H37FN4O2S |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | N,N-dibenzyl-2-[[4-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]([C@H]1C[C@H]2CC[C@H]1C2)n1c(COc2ccccc2F)nnc1SCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H37FN4O2S/c1-24(29-19-27-16-17-28(29)18-27)39-32(22-41-31-15-9-8-14-30(31)35)36-37-34(39)42-23-33(40)38(20-25-10-4-2-5-11-25)21-26-12-6-3-7-13-26/h2-15,24,27-29H,16-23H2,1H3/t24-,27-,28-,29+/m0/s1 |
| InChIKey | UQHJBWDPRIIFCI-HSNHEXMOSA-N |
| XLogP | 7.31 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |