C15H23N7O2S — CID 129375991
N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide (PubChem CID 129375991) has the molecular formula C15H23N7O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 129375991 |
| Molecular Formula | C15H23N7O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]acetamide |
| SMILES | C[C@@H](NC(=O)NC(=O)CSc1nc(N)nc(N)n1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H23N7O2S/c1-7(10-5-8-2-3-9(10)4-8)18-14(24)19-11(23)6-25-15-21-12(16)20-13(17)22-15/h7-10H,2-6H2,1H3,(H2,18,19,23,24)(H4,16,17,20,21,22)/t7-,8+,9+,10+/m1/s1 |
| InChIKey | TYTOOKWAQOLAKV-KATARQTJSA-N |
| XLogP | 0.78 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |