About N-cyclohexa-2,4-dien-1-ylaniline
N-cyclohexa-2,4-dien-1-ylaniline (PubChem CID 12937626) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-ylaniline.
Molecular Properties
| Compound Name | N-cyclohexa-2,4-dien-1-ylaniline |
| PubChem CID | 12937626 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-ylaniline |
| SMILES | C1=CCC(Nc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H13N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,12-13H,10H2 |
| InChIKey | ANEBMVONCYUSJZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-2,4-dien-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-2,4-dien-1-ylaniline?
The IUPAC name of N-cyclohexa-2,4-dien-1-ylaniline (CID 12937626) is N-cyclohexa-2,4-dien-1-ylaniline.
What is the SMILES notation for N-cyclohexa-2,4-dien-1-ylaniline?
The canonical SMILES for N-cyclohexa-2,4-dien-1-ylaniline is C1=CCC(Nc2ccccc2)C=C1.
What is the InChIKey of N-cyclohexa-2,4-dien-1-ylaniline?
The InChIKey is ANEBMVONCYUSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,12-13H,10H2.
What are the key properties of N-cyclohexa-2,4-dien-1-ylaniline?
N-cyclohexa-2,4-dien-1-ylaniline has a molecular weight of 171.24 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-2,4-dien-1-ylaniline is sourced from PubChem (CID 12937626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).