About N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline
N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline (PubChem CID 12937631) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline.
Molecular Properties
| Compound Name | N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline |
| PubChem CID | 12937631 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline |
| SMILES | C1=CC[C@@H](Nc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H13N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,12-13H,10H2/t12-/m0/s1 |
| InChIKey | ANEBMVONCYUSJZ-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline?
The IUPAC name of N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline (CID 12937631) is N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline.
What is the SMILES notation for N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline?
The canonical SMILES for N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline is C1=CC[C@@H](Nc2ccccc2)C=C1.
What is the InChIKey of N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline?
The InChIKey is ANEBMVONCYUSJZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H13N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,12-13H,10H2/t12-/m0/s1.
What are the key properties of N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline?
N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline has a molecular weight of 171.24 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-cyclohexa-2,4-dien-1-yl]aniline is sourced from PubChem (CID 12937631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).