C8H10Cl3N — CID 12937687
2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonitrile (PubChem CID 12937687) has the molecular formula C8H10Cl3N and a molecular weight of 226.53 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonitrile.
| Compound Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 12937687 |
| Molecular Formula | C8H10Cl3N |
| Molecular Weight | 226.53 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonitrile |
| SMILES | CC1(C)C(C#N)C1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl3N/c1-7(2)5(6(7)4-12)3-8(9,10)11/h5-6H,3H2,1-2H3 |
| InChIKey | LQUTXFUOLVJWCM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|