About trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one
trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one (PubChem CID 129377272) has the molecular formula C17H23BrO
and a molecular weight of 323.27 g/mol. Its IUPAC name is trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one |
| PubChem CID | 129377272 |
| Molecular Formula | C17H23BrO |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one |
| SMILES | CC(C)(C)[C@@H]1CCC(=O)[C@@H](Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H23BrO/c1-17(2,3)14-6-9-16(19)13(11-14)10-12-4-7-15(18)8-5-12/h4-5,7-8,13-14H,6,9-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | HVSJLRUHAWXFOK-UONOGXRCSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one?
The IUPAC name of trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one (CID 129377272) is trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one.
What is the SMILES notation for trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one?
The canonical SMILES for trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one is CC(C)(C)[C@@H]1CCC(=O)[C@@H](Cc2ccc(Br)cc2)C1.
What is the InChIKey of trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one?
The InChIKey is HVSJLRUHAWXFOK-UONOGXRCSA-N. The full InChI is InChI=1S/C17H23BrO/c1-17(2,3)14-6-9-16(19)13(11-14)10-12-4-7-15(18)8-5-12/h4-5,7-8,13-14H,6,9-11H2,1-3H3/t13-,14+/m0/s1.
What are the key properties of trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one?
trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one has a molecular weight of 323.27 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,4R)-2-[(4-bromophenyl)methyl]-4-tert-butylcyclohexan-1-one is sourced from PubChem (CID 129377272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).