C17H23N3O3 — CID 129377894
N-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-(1-ethyl-6-oxo-3-pyridinyl)oxamide (PubChem CID 129377894) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-(1-ethyl-6-oxo-3-pyridinyl)oxamide.
| Compound Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-(1-ethyl-6-oxo-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 129377894 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-N'-(1-ethyl-6-oxo-3-pyridinyl)oxamide |
| SMILES | CCn1cc(NC(=O)C(=O)NC[C@H]2C[C@H]3CC[C@H]2C3)ccc1=O |
| InChI | InChI=1S/C17H23N3O3/c1-2-20-10-14(5-6-15(20)21)19-17(23)16(22)18-9-13-8-11-3-4-12(13)7-11/h5-6,10-13H,2-4,7-9H2,1H3,(H,18,22)(H,19,23)/t11-,12-,13+/m0/s1 |
| InChIKey | RLXILOPLIQYBEX-RWMBFGLXSA-N |
| XLogP | 1.36 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|