About 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile
5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile (PubChem CID 129378040) has the molecular formula C17H24N2O2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile.
Molecular Properties
| Compound Name | 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile |
| PubChem CID | 129378040 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCCCC#N)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-15-14-19(22(20,21)13-7-3-6-11-18)12-10-17(15)16-8-4-2-5-9-16/h2,4-5,8-9,15,17H,3,6-7,10,12-14H2,1H3/t15-,17-/m1/s1 |
| InChIKey | MJQRRNOAQGGCDS-NVXWUHKLSA-N |
| XLogP | 3.14 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile?
The IUPAC name of 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile (CID 129378040) is 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile.
What is the SMILES notation for 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile?
The canonical SMILES for 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile is C[C@@H]1CN(S(=O)(=O)CCCCC#N)CC[C@H]1c1ccccc1.
What is the InChIKey of 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile?
The InChIKey is MJQRRNOAQGGCDS-NVXWUHKLSA-N. The full InChI is InChI=1S/C17H24N2O2S/c1-15-14-19(22(20,21)13-7-3-6-11-18)12-10-17(15)16-8-4-2-5-9-16/h2,4-5,8-9,15,17H,3,6-7,10,12-14H2,1H3/t15-,17-/m1/s1.
What are the key properties of 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile?
5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile has a molecular weight of 320.46 g/mol, XLogP of 3.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]sulfonylpentanenitrile is sourced from PubChem (CID 129378040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).