C15H30N2O2 — CID 129378274
(2S)-2-(azepan-1-yl)-N-[(2R,4S)-4-hydroxy-2-methylpentyl]propanamide (PubChem CID 129378274) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2S)-2-(azepan-1-yl)-N-[(2R,4S)-4-hydroxy-2-methylpentyl]propanamide.
| Compound Name | (2S)-2-(azepan-1-yl)-N-[(2R,4S)-4-hydroxy-2-methylpentyl]propanamide |
|---|---|
| PubChem CID | 129378274 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (2S)-2-(azepan-1-yl)-N-[(2R,4S)-4-hydroxy-2-methylpentyl]propanamide |
| SMILES | C[C@@H](CNC(=O)[C@H](C)N1CCCCCC1)C[C@H](C)O |
| InChI | InChI=1S/C15H30N2O2/c1-12(10-13(2)18)11-16-15(19)14(3)17-8-6-4-5-7-9-17/h12-14,18H,4-11H2,1-3H3,(H,16,19)/t12-,13+,14+/m1/s1 |
| InChIKey | UCPWUTNGQFGRQB-RDBSUJKOSA-N |
| XLogP | 1.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |