About 2-phenylbuta-2,3-dien-1-amine
2-phenylbuta-2,3-dien-1-amine (PubChem CID 12937833) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-phenylbuta-2,3-dien-1-amine.
Molecular Properties
| Compound Name | 2-phenylbuta-2,3-dien-1-amine |
| PubChem CID | 12937833 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-phenylbuta-2,3-dien-1-amine |
| SMILES | C=C=C(CN)c1ccccc1 |
| InChI | InChI=1S/C10H11N/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7H,1,8,11H2 |
| InChIKey | YYKWNDZETHOUJQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylbuta-2,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbuta-2,3-dien-1-amine?
The IUPAC name of 2-phenylbuta-2,3-dien-1-amine (CID 12937833) is 2-phenylbuta-2,3-dien-1-amine.
What is the SMILES notation for 2-phenylbuta-2,3-dien-1-amine?
The canonical SMILES for 2-phenylbuta-2,3-dien-1-amine is C=C=C(CN)c1ccccc1.
What is the InChIKey of 2-phenylbuta-2,3-dien-1-amine?
The InChIKey is YYKWNDZETHOUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7H,1,8,11H2.
What are the key properties of 2-phenylbuta-2,3-dien-1-amine?
2-phenylbuta-2,3-dien-1-amine has a molecular weight of 145.20 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbuta-2,3-dien-1-amine is sourced from PubChem (CID 12937833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).