C17H30N4O2 — CID 129378400
N-(3-acetamidopropyl)-4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide (PubChem CID 129378400) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(3-acetamidopropyl)-4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide.
| Compound Name | N-(3-acetamidopropyl)-4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129378400 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-(3-acetamidopropyl)-4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide |
| SMILES | CC(=O)NCCCNC(=O)N1CCN([C@@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C17H30N4O2/c1-13(22)18-5-2-6-19-17(23)21-9-7-20(8-10-21)16-12-14-3-4-15(16)11-14/h14-16H,2-12H2,1H3,(H,18,22)(H,19,23)/t14-,15-,16+/m0/s1 |
| InChIKey | MHOWAAOAQBZUSA-HRCADAONSA-N |
| XLogP | 1.03 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|