About 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene
1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene (PubChem CID 12937845) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene.
Molecular Properties
| Compound Name | 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene |
| PubChem CID | 12937845 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene |
| SMILES | CC(C)=C1C(C)=C(C)C1=C(C)C |
| InChI | InChI=1S/C12H18/c1-7(2)11-9(5)10(6)12(11)8(3)4/h1-6H3 |
| InChIKey | WZUUCQDMBKQIFH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene?
The IUPAC name of 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene (CID 12937845) is 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene.
What is the SMILES notation for 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene?
The canonical SMILES for 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene is CC(C)=C1C(C)=C(C)C1=C(C)C.
What is the InChIKey of 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene?
The InChIKey is WZUUCQDMBKQIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-7(2)11-9(5)10(6)12(11)8(3)4/h1-6H3.
What are the key properties of 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene?
1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene has a molecular weight of 162.28 g/mol, XLogP of 4.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3,4-di(propan-2-ylidene)cyclobutene is sourced from PubChem (CID 12937845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).