About (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide
(2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide (PubChem CID 129378770) has the molecular formula C16H18N4O
and a molecular weight of 282.35 g/mol. Its IUPAC name is (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide |
| PubChem CID | 129378770 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1ncccn1)N1C[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C16H18N4O/c1-11-10-20(14-7-4-3-6-13(11)14)12(2)15(21)19-16-17-8-5-9-18-16/h3-9,11-12H,10H2,1-2H3,(H,17,18,19,21)/t11-,12+/m0/s1 |
| InChIKey | CHNLWAPDXVOGEZ-NWDGAFQWSA-N |
| XLogP | 2.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide?
The IUPAC name of (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide (CID 129378770) is (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide.
What is the SMILES notation for (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide?
The canonical SMILES for (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide is C[C@H](C(=O)Nc1ncccn1)N1C[C@H](C)c2ccccc21.
What is the InChIKey of (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide?
The InChIKey is CHNLWAPDXVOGEZ-NWDGAFQWSA-N. The full InChI is InChI=1S/C16H18N4O/c1-11-10-20(14-7-4-3-6-13(11)14)12(2)15(21)19-16-17-8-5-9-18-16/h3-9,11-12H,10H2,1-2H3,(H,17,18,19,21)/t11-,12+/m0/s1.
What are the key properties of (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide?
(2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide has a molecular weight of 282.35 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3R)-3-methyl-2,3-dihydroindol-1-yl]-N-pyrimidin-2-ylpropanamide is sourced from PubChem (CID 129378770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).