C12H21NO2S — CID 129379273
tert-butyl (3R)-3-cyclopropylthiomorpholine-4-carboxylate (PubChem CID 129379273) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is tert-butyl (3R)-3-cyclopropylthiomorpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-cyclopropylthiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 129379273 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | tert-butyl (3R)-3-cyclopropylthiomorpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCSC[C@H]1C1CC1 |
| InChI | InChI=1S/C12H21NO2S/c1-12(2,3)15-11(14)13-6-7-16-8-10(13)9-4-5-9/h9-10H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | NNNMGVGMZFCKLW-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |