C19H16N2O4 — CID 12938
1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 12938) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12938 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H16N2O4/c1-2-19(14-11-7-4-8-12-14)16(23)20-18(25)21(17(19)24)15(22)13-9-5-3-6-10-13/h3-12H,2H2,1H3,(H,20,23,25) |
| InChIKey | QMOWPJIFTHVQMB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|