C10H11FO — CID 129380109
(1R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 129380109) has the molecular formula C10H11FO and a molecular weight of 166.20 g/mol. Its IUPAC name is (1R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 129380109 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (1R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1CCCc2c(F)cccc21 |
| InChI | InChI=1S/C10H11FO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5,10,12H,2-3,6H2/t10-/m1/s1 |
| InChIKey | BMQLWJAPLLELEF-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |