C14H17BrClNO2 — CID 129380773
2-(2-bromo-5-chlorophenyl)-N-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]acetamide (PubChem CID 129380773) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is 2-(2-bromo-5-chlorophenyl)-N-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]acetamide.
| Compound Name | 2-(2-bromo-5-chlorophenyl)-N-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 129380773 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-(2-bromo-5-chlorophenyl)-N-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1cc(Cl)ccc1Br)[C@@H]1CCOC1 |
| InChI | InChI=1S/C14H17BrClNO2/c1-9(10-4-5-19-8-10)17-14(18)7-11-6-12(16)2-3-13(11)15/h2-3,6,9-10H,4-5,7-8H2,1H3,(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | JVQVIZMHOOKXGA-NXEZZACHSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |