C13H19F3N4O — CID 129381594
N-[2-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 129381594) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is N-[2-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 129381594 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[2-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCN[C@@H]1CCC[C@@H](C(F)(F)F)C1)c1ccn[nH]1 |
| InChI | InChI=1S/C13H19F3N4O/c14-13(15,16)9-2-1-3-10(8-9)17-6-7-18-12(21)11-4-5-19-20-11/h4-5,9-10,17H,1-3,6-8H2,(H,18,21)(H,19,20)/t9-,10-/m1/s1 |
| InChIKey | LHQFJPHCEPHVEM-NXEZZACHSA-N |
| XLogP | 1.85 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|