About (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile
(3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile (PubChem CID 129382347) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile.
Molecular Properties
| Compound Name | (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile |
| PubChem CID | 129382347 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile |
| SMILES | N#CC1[C@H]2CC3C[C@H]1CN(C3)C2 |
| InChI | InChI=1S/C10H14N2/c11-3-10-8-1-7-2-9(10)6-12(4-7)5-8/h7-10H,1-2,4-6H2/t7?,8-,9-,10?/m0/s1 |
| InChIKey | BABMIZCGANKZIK-ZNHWEVIXSA-N |
| XLogP | 1.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile?
The IUPAC name of (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile (CID 129382347) is (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile.
What is the SMILES notation for (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile?
The canonical SMILES for (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile is N#CC1[C@H]2CC3C[C@H]1CN(C3)C2.
What is the InChIKey of (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile?
The InChIKey is BABMIZCGANKZIK-ZNHWEVIXSA-N. The full InChI is InChI=1S/C10H14N2/c11-3-10-8-1-7-2-9(10)6-12(4-7)5-8/h7-10H,1-2,4-6H2/t7?,8-,9-,10?/m0/s1.
What are the key properties of (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile?
(3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile has a molecular weight of 162.24 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-1-azatricyclo[3.3.1.13,7]decane-4-carbonitrile is sourced from PubChem (CID 129382347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).