C28H27N3O5 — CID 129382484
ethyl 3-[[(1R,5R,6S,7R)-3-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]benzoate (PubChem CID 129382484) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is ethyl 3-[[(1R,5R,6S,7R)-3-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(1R,5R,6S,7R)-3-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 129382484 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | ethyl 3-[[(1R,5R,6S,7R)-3-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCc4c[nH]c5ccccc45)C[C@@]34C=C[C@H]2O4)c1 |
| InChI | InChI=1S/C28H27N3O5/c1-2-35-27(34)17-6-5-7-19(14-17)30-25(32)23-22-10-12-28(36-22)16-31(26(33)24(23)28)13-11-18-15-29-21-9-4-3-8-20(18)21/h3-10,12,14-15,22-24,29H,2,11,13,16H2,1H3,(H,30,32)/t22-,23-,24+,28+/m1/s1 |
| InChIKey | BWMLNTZNMVKVKI-DFIMXKNXSA-N |
| XLogP | 3.31 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|