About N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide
N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide (PubChem CID 129382995) has the molecular formula C18H28N4O
and a molecular weight of 316.45 g/mol. Its IUPAC name is N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide |
| PubChem CID | 129382995 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide |
| SMILES | C[C@H]1C[C@H](C/N=C(\N)N2CCOCC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H28N4O/c1-15-11-17(12-20-18(19)21-7-9-23-10-8-21)14-22(15)13-16-5-3-2-4-6-16/h2-6,15,17H,7-14H2,1H3,(H2,19,20)/t15-,17+/m0/s1 |
| InChIKey | ZZHSODUXLAWJEP-DOTOQJQBSA-N |
| XLogP | 1.54 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The IUPAC name of N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide (CID 129382995) is N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide.
What is the SMILES notation for N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The canonical SMILES for N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide is C[C@H]1C[C@H](C/N=C(\N)N2CCOCC2)CN1Cc1ccccc1.
What is the InChIKey of N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The InChIKey is ZZHSODUXLAWJEP-DOTOQJQBSA-N. The full InChI is InChI=1S/C18H28N4O/c1-15-11-17(12-20-18(19)21-7-9-23-10-8-21)14-22(15)13-16-5-3-2-4-6-16/h2-6,15,17H,7-14H2,1H3,(H2,19,20)/t15-,17+/m0/s1.
What are the key properties of N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide has a molecular weight of 316.45 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(3S,5S)-1-benzyl-5-methylpyrrolidin-3-yl]methyl]morpholine-4-carboximidamide is sourced from PubChem (CID 129382995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).