C19H38O4 — CID 129383460
[(2R,4R)-4-(tetradecoxymethyl)-1,3-dioxolan-2-yl]methanol (PubChem CID 129383460) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is [(2R,4R)-4-(tetradecoxymethyl)-1,3-dioxolan-2-yl]methanol.
| Compound Name | [(2R,4R)-4-(tetradecoxymethyl)-1,3-dioxolan-2-yl]methanol |
|---|---|
| PubChem CID | 129383460 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | [(2R,4R)-4-(tetradecoxymethyl)-1,3-dioxolan-2-yl]methanol |
| SMILES | CCCCCCCCCCCCCCOC[C@@H]1CO[C@@H](CO)O1 |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-16-18-17-22-19(15-20)23-18/h18-20H,2-17H2,1H3/t18-,19-/m1/s1 |
| InChIKey | MAVLCXYTXGLYMX-RTBURBONSA-N |
| XLogP | 4.44 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|