C20H37BrO3 — CID 129383512
methyl (2R,4R)-4-bromo-2-butyl-4-methyl-3-oxotetradecanoate (PubChem CID 129383512) has the molecular formula C20H37BrO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is methyl (2R,4R)-4-bromo-2-butyl-4-methyl-3-oxotetradecanoate.
| Compound Name | methyl (2R,4R)-4-bromo-2-butyl-4-methyl-3-oxotetradecanoate |
|---|---|
| PubChem CID | 129383512 |
| Molecular Formula | C20H37BrO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl (2R,4R)-4-bromo-2-butyl-4-methyl-3-oxotetradecanoate |
| SMILES | CCCCCCCCCC[C@@](C)(Br)C(=O)[C@@H](CCCC)C(=O)OC |
| InChI | InChI=1S/C20H37BrO3/c1-5-7-9-10-11-12-13-14-16-20(3,21)18(22)17(15-8-6-2)19(23)24-4/h17H,5-16H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | MKTNCPGLOKUTSU-YLJYHZDGSA-N |
| XLogP | 6.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|