C14H17F3O3 — CID 129383802
(2S)-2-hydroxy-4-(4-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanal (PubChem CID 129383802) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-(4-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanal.
| Compound Name | (2S)-2-hydroxy-4-(4-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanal |
|---|---|
| PubChem CID | 129383802 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (2S)-2-hydroxy-4-(4-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentanal |
| SMILES | COc1ccc(C(C)(C)C[C@](O)(C=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3/c1-12(2,8-13(19,9-18)14(15,16)17)10-4-6-11(20-3)7-5-10/h4-7,9,19H,8H2,1-3H3/t13-/m0/s1 |
| InChIKey | IRQSXUSKHUAQFO-ZDUSSCGKSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|