About (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol
(R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol (PubChem CID 129384462) has the molecular formula C17H12Cl2FNO
and a molecular weight of 336.19 g/mol. Its IUPAC name is (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol.
Molecular Properties
| Compound Name | (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol |
| PubChem CID | 129384462 |
| Molecular Formula | C17H12Cl2FNO |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol |
| SMILES | O[C@H](c1ccc(F)cc1)c1c[nH]cc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2FNO/c18-15-6-3-11(7-16(15)19)13-8-21-9-14(13)17(22)10-1-4-12(20)5-2-10/h1-9,17,21-22H/t17-/m1/s1 |
| InChIKey | FTSFTMJPCXYKFS-QGZVFWFLSA-N |
| XLogP | 5.21 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol?
The IUPAC name of (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol (CID 129384462) is (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol.
What is the SMILES notation for (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol?
The canonical SMILES for (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol is O[C@H](c1ccc(F)cc1)c1c[nH]cc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol?
The InChIKey is FTSFTMJPCXYKFS-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H12Cl2FNO/c18-15-6-3-11(7-16(15)19)13-8-21-9-14(13)17(22)10-1-4-12(20)5-2-10/h1-9,17,21-22H/t17-/m1/s1.
What are the key properties of (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol?
(R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol has a molecular weight of 336.19 g/mol, XLogP of 5.21, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]-(4-fluorophenyl)methanol is sourced from PubChem (CID 129384462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).