C19H18N2 — CID 129385280
7-[(4S)-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]isoquinoline (PubChem CID 129385280) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 7-[(4S)-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]isoquinoline.
| Compound Name | 7-[(4S)-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]isoquinoline |
|---|---|
| PubChem CID | 129385280 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 7-[(4S)-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]isoquinoline |
| SMILES | CN1Cc2ccccc2[C@H](c2ccc3ccncc3c2)C1 |
| InChI | InChI=1S/C19H18N2/c1-21-12-16-4-2-3-5-18(16)19(13-21)15-7-6-14-8-9-20-11-17(14)10-15/h2-11,19H,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | RZAMZNWSJJJJJJ-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |