C20H14N4O3 — CID 129385556
3-nitro-4-[(9S)-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl]phenol (PubChem CID 129385556) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3-nitro-4-[(9S)-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl]phenol.
| Compound Name | 3-nitro-4-[(9S)-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl]phenol |
|---|---|
| PubChem CID | 129385556 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-nitro-4-[(9S)-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2,4,6,10,13,15-heptaen-9-yl]phenol |
| SMILES | O=[N+]([O-])c1cc(O)ccc1[C@H]1Nc2ccccc2-c2ccnc3[nH]cc1c23 |
| InChI | InChI=1S/C20H14N4O3/c25-11-5-6-14(17(9-11)24(26)27)19-15-10-22-20-18(15)13(7-8-21-20)12-3-1-2-4-16(12)23-19/h1-10,19,23,25H,(H,21,22)/t19-/m1/s1 |
| InChIKey | PUBNRLXRMDMGGE-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|