C16H17BrN2O — CID 129386216
4-[(R)-amino-(3-bromophenyl)methyl]-N,N-dimethylbenzamide (PubChem CID 129386216) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 4-[(R)-amino-(3-bromophenyl)methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(R)-amino-(3-bromophenyl)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 129386216 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-[(R)-amino-(3-bromophenyl)methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc([C@@H](N)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C16H17BrN2O/c1-19(2)16(20)12-8-6-11(7-9-12)15(18)13-4-3-5-14(17)10-13/h3-10,15H,18H2,1-2H3/t15-/m1/s1 |
| InChIKey | RNEVSDKYOXNTCR-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |