C10H12OS — CID 129386416
(4S)-4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol (PubChem CID 129386416) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is (4S)-4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol.
| Compound Name | (4S)-4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 129386416 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (4S)-4-ethenyl-6,7-dihydro-5H-1-benzothiophen-4-ol |
| SMILES | C=C[C@@]1(O)CCCc2sccc21 |
| InChI | InChI=1S/C10H12OS/c1-2-10(11)6-3-4-9-8(10)5-7-12-9/h2,5,7,11H,1,3-4,6H2/t10-/m1/s1 |
| InChIKey | KUJCNPUQFWUEEX-SNVBAGLBSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|