About 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide (PubChem CID 129386817) has the molecular formula C17H21N5O2S
and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide.
Molecular Properties
| Compound Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide |
| PubChem CID | 129386817 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide |
| SMILES | Cc1cc(Nc2cc(N[C@H]3CCCCNC3=O)ccc2C(N)=O)sn1 |
| InChI | InChI=1S/C17H21N5O2S/c1-10-8-15(25-22-10)21-14-9-11(5-6-12(14)16(18)23)20-13-4-2-3-7-19-17(13)24/h5-6,8-9,13,20-21H,2-4,7H2,1H3,(H2,18,23)(H,19,24)/t13-/m0/s1 |
| InChIKey | CGISCFSCCGPNQN-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide?
The IUPAC name of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide (CID 129386817) is 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide.
What is the SMILES notation for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide?
The canonical SMILES for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide is Cc1cc(Nc2cc(N[C@H]3CCCCNC3=O)ccc2C(N)=O)sn1.
What is the InChIKey of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide?
The InChIKey is CGISCFSCCGPNQN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H21N5O2S/c1-10-8-15(25-22-10)21-14-9-11(5-6-12(14)16(18)23)20-13-4-2-3-7-19-17(13)24/h5-6,8-9,13,20-21H,2-4,7H2,1H3,(H2,18,23)(H,19,24)/t13-/m0/s1.
What are the key properties of 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide?
2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide has a molecular weight of 359.46 g/mol, XLogP of 2.37, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-[[(3S)-2-oxoazepan-3-yl]amino]benzamide is sourced from PubChem (CID 129386817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).