C23H25FN4S — CID 129387106
N-[4-[[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]methyl]-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 129387106) has the molecular formula C23H25FN4S and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[4-[[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]methyl]-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[4-[[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]methyl]-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 129387106 |
| Molecular Formula | C23H25FN4S |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[4-[[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]methyl]-2-pyridinyl]-5-(4-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(-c2cnc(Nc3cc(C[C@H]4CCC[C@@H]5CNC[C@@H]54)ccn3)s2)cc1 |
| InChI | InChI=1S/C23H25FN4S/c24-19-6-4-16(5-7-19)21-14-27-23(29-21)28-22-11-15(8-9-26-22)10-17-2-1-3-18-12-25-13-20(17)18/h4-9,11,14,17-18,20,25H,1-3,10,12-13H2,(H,26,27,28)/t17-,18-,20-/m1/s1 |
| InChIKey | VOXBSEMFKLOBNQ-QWFCFKBJSA-N |
| XLogP | 5.27 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |