C13H14ClN5 — CID 129387464
5-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-7-chloropyrido[3,4-b]pyrazine (PubChem CID 129387464) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-7-chloropyrido[3,4-b]pyrazine.
| Compound Name | 5-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-7-chloropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 129387464 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-7-chloropyrido[3,4-b]pyrazine |
| SMILES | Clc1cc2nccnc2c(N2C[C@@H]3CCN[C@@H]3C2)n1 |
| InChI | InChI=1S/C13H14ClN5/c14-11-5-9-12(17-4-3-16-9)13(18-11)19-6-8-1-2-15-10(8)7-19/h3-5,8,10,15H,1-2,6-7H2/t8-,10+/m0/s1 |
| InChIKey | PSDGTLPMBXMSJQ-WCBMZHEXSA-N |
| XLogP | 1.48 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|