C16H21Cl2N — CID 129388840
1-[3-[(1R)-2,2-dichloro-1-methylcyclopropyl]phenyl]cyclohexan-1-amine (PubChem CID 129388840) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is 1-[3-[(1R)-2,2-dichloro-1-methylcyclopropyl]phenyl]cyclohexan-1-amine.
| Compound Name | 1-[3-[(1R)-2,2-dichloro-1-methylcyclopropyl]phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 129388840 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[3-[(1R)-2,2-dichloro-1-methylcyclopropyl]phenyl]cyclohexan-1-amine |
| SMILES | C[C@]1(c2cccc(C3(N)CCCCC3)c2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H21Cl2N/c1-14(11-16(14,17)18)12-6-5-7-13(10-12)15(19)8-3-2-4-9-15/h5-7,10H,2-4,8-9,11,19H2,1H3/t14-/m1/s1 |
| InChIKey | CAEUCFSUVCWZKI-CQSZACIVSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|