C14H19FO3 — CID 129388869
(2R)-2-[2-(4-fluorophenoxy)ethyl]-4-[(2S)-oxiran-2-yl]butan-1-ol (PubChem CID 129388869) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is (2R)-2-[2-(4-fluorophenoxy)ethyl]-4-[(2S)-oxiran-2-yl]butan-1-ol.
| Compound Name | (2R)-2-[2-(4-fluorophenoxy)ethyl]-4-[(2S)-oxiran-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 129388869 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2R)-2-[2-(4-fluorophenoxy)ethyl]-4-[(2S)-oxiran-2-yl]butan-1-ol |
| SMILES | OC[C@@H](CCOc1ccc(F)cc1)CC[C@H]1CO1 |
| InChI | InChI=1S/C14H19FO3/c15-12-2-5-13(6-3-12)17-8-7-11(9-16)1-4-14-10-18-14/h2-3,5-6,11,14,16H,1,4,7-10H2/t11-,14+/m1/s1 |
| InChIKey | XKXYPXLHZKCADI-RISCZKNCSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|