C33H38N2O2 — CID 129388947
1-[2-[4-[(S)-(1-benzylpyrrol-2-yl)-(4-methoxyphenyl)methyl]phenoxy]ethyl]azepane (PubChem CID 129388947) has the molecular formula C33H38N2O2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 1-[2-[4-[(S)-(1-benzylpyrrol-2-yl)-(4-methoxyphenyl)methyl]phenoxy]ethyl]azepane.
| Compound Name | 1-[2-[4-[(S)-(1-benzylpyrrol-2-yl)-(4-methoxyphenyl)methyl]phenoxy]ethyl]azepane |
|---|---|
| PubChem CID | 129388947 |
| Molecular Formula | C33H38N2O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 1-[2-[4-[(S)-(1-benzylpyrrol-2-yl)-(4-methoxyphenyl)methyl]phenoxy]ethyl]azepane |
| SMILES | COc1ccc([C@@H](c2ccc(OCCN3CCCCCC3)cc2)c2cccn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H38N2O2/c1-36-30-17-13-28(14-18-30)33(32-12-9-23-35(32)26-27-10-5-4-6-11-27)29-15-19-31(20-16-29)37-25-24-34-21-7-2-3-8-22-34/h4-6,9-20,23,33H,2-3,7-8,21-22,24-26H2,1H3/t33-/m0/s1 |
| InChIKey | WFWKZSVSNQYIKM-XIFFEERXSA-N |
| XLogP | 6.98 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |