C9H11BrN2O — CID 129389119
(3R)-6-bromo-3,4-dimethyl-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 129389119) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is (3R)-6-bromo-3,4-dimethyl-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | (3R)-6-bromo-3,4-dimethyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 129389119 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (3R)-6-bromo-3,4-dimethyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | C[C@@H]1COc2ccc(Br)nc2N1C |
| InChI | InChI=1S/C9H11BrN2O/c1-6-5-13-7-3-4-8(10)11-9(7)12(6)2/h3-4,6H,5H2,1-2H3/t6-/m1/s1 |
| InChIKey | CILCFYSAKKNWRR-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|