C19H16ClN — CID 129389639
4-chloro-2-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]quinoline (PubChem CID 129389639) has the molecular formula C19H16ClN and a molecular weight of 293.80 g/mol. Its IUPAC name is 4-chloro-2-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]quinoline.
| Compound Name | 4-chloro-2-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]quinoline |
|---|---|
| PubChem CID | 129389639 |
| Molecular Formula | C19H16ClN |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-chloro-2-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]quinoline |
| SMILES | Clc1cc([C@@H]2CCc3ccccc3C2)nc2ccccc12 |
| InChI | InChI=1S/C19H16ClN/c20-17-12-19(21-18-8-4-3-7-16(17)18)15-10-9-13-5-1-2-6-14(13)11-15/h1-8,12,15H,9-11H2/t15-/m1/s1 |
| InChIKey | SRVXIKUVPAOPMM-OAHLLOKOSA-N |
| XLogP | 5.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |