C7H13NO2 — CID 129389910
(3R,5R)-1-oxa-7-azaspiro[4.4]nonan-3-ol (PubChem CID 129389910) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3R,5R)-1-oxa-7-azaspiro[4.4]nonan-3-ol.
| Compound Name | (3R,5R)-1-oxa-7-azaspiro[4.4]nonan-3-ol |
|---|---|
| PubChem CID | 129389910 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3R,5R)-1-oxa-7-azaspiro[4.4]nonan-3-ol |
| SMILES | O[C@H]1CO[C@]2(CCNC2)C1 |
| InChI | InChI=1S/C7H13NO2/c9-6-3-7(10-4-6)1-2-8-5-7/h6,8-9H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | QPMVKECMMBYVGU-RNFRBKRXSA-N |
| XLogP | -0.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |