About (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione
(5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione (PubChem CID 12939009) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione.
Molecular Properties
| Compound Name | (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione |
| PubChem CID | 12939009 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione |
| SMILES | O=C1CC[C@]2(CCC(=O)OC2=O)N1 |
| InChI | InChI=1S/C8H9NO4/c10-5-1-3-8(9-5)4-2-6(11)13-7(8)12/h1-4H2,(H,9,10)/t8-/m1/s1 |
| InChIKey | CQELCIVTULKSAE-MRVPVSSYSA-N |
| XLogP | -0.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione?
The IUPAC name of (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione (CID 12939009) is (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione.
What is the SMILES notation for (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione?
The canonical SMILES for (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione is O=C1CC[C@]2(CCC(=O)OC2=O)N1.
What is the InChIKey of (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione?
The InChIKey is CQELCIVTULKSAE-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H9NO4/c10-5-1-3-8(9-5)4-2-6(11)13-7(8)12/h1-4H2,(H,9,10)/t8-/m1/s1.
What are the key properties of (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione?
(5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione has a molecular weight of 183.16 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-9-oxa-1-azaspiro[4.5]decane-2,8,10-trione is sourced from PubChem (CID 12939009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).