About 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol
2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol (PubChem CID 129390481) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol |
| PubChem CID | 129390481 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol |
| SMILES | OCC[C@H]1NCc2ccccc21 |
| InChI | InChI=1S/C10H13NO/c12-6-5-10-9-4-2-1-3-8(9)7-11-10/h1-4,10-12H,5-7H2/t10-/m1/s1 |
| InChIKey | QRODAZJXMKMZER-SNVBAGLBSA-N |
| XLogP | 1.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol?
The IUPAC name of 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol (CID 129390481) is 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol.
What is the SMILES notation for 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol?
The canonical SMILES for 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol is OCC[C@H]1NCc2ccccc21.
What is the InChIKey of 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol?
The InChIKey is QRODAZJXMKMZER-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H13NO/c12-6-5-10-9-4-2-1-3-8(9)7-11-10/h1-4,10-12H,5-7H2/t10-/m1/s1.
What are the key properties of 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol?
2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol has a molecular weight of 163.22 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-2,3-dihydro-1H-isoindol-1-yl]ethanol is sourced from PubChem (CID 129390481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).