C15H22O10 — CID 12939087
[(2S,4S)-2,3,4,5-tetraacetyloxypentyl] acetate (PubChem CID 12939087) has the molecular formula C15H22O10 and a molecular weight of 362.33 g/mol. Its IUPAC name is [(2S,4S)-2,3,4,5-tetraacetyloxypentyl] acetate.
| Compound Name | [(2S,4S)-2,3,4,5-tetraacetyloxypentyl] acetate |
|---|---|
| PubChem CID | 12939087 |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [(2S,4S)-2,3,4,5-tetraacetyloxypentyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)C(OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H22O10/c1-8(16)21-6-13(23-10(3)18)15(25-12(5)20)14(24-11(4)19)7-22-9(2)17/h13-15H,6-7H2,1-5H3/t13-,14-/m0/s1 |
| InChIKey | NVKPIAUSOPISJK-KBPBESRZSA-N |
| XLogP | -0.09 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|