C10H16ClN5O2 — CID 129391415
(1E,2E)-N-propan-2-yloxy-2-propan-2-yloxyimino-2-(1,2,4-triazol-1-yl)ethanimidoyl chloride (PubChem CID 129391415) has the molecular formula C10H16ClN5O2 and a molecular weight of 273.72 g/mol. Its IUPAC name is (1E,2E)-N-propan-2-yloxy-2-propan-2-yloxyimino-2-(1,2,4-triazol-1-yl)ethanimidoyl chloride.
| Compound Name | (1E,2E)-N-propan-2-yloxy-2-propan-2-yloxyimino-2-(1,2,4-triazol-1-yl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 129391415 |
| Molecular Formula | C10H16ClN5O2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (1E,2E)-N-propan-2-yloxy-2-propan-2-yloxyimino-2-(1,2,4-triazol-1-yl)ethanimidoyl chloride |
| SMILES | CC(C)O/N=C(Cl)\C(=N/OC(C)C)n1cncn1 |
| InChI | InChI=1S/C10H16ClN5O2/c1-7(2)17-14-9(11)10(15-18-8(3)4)16-6-12-5-13-16/h5-8H,1-4H3/b14-9+,15-10+ |
| InChIKey | QZCMWMSZKHYHCK-AOEKMSOUSA-N |
| XLogP | 1.84 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|